On Target PR_HIV1 0.19620253/CHEMBL494500
For the given ligand 1-deoxymannojirimycin, we have found in our database that, being scored 0.19620253, the most similar ligand is CHEMBL494500. Check out the elaboration below.
| 1-deoxymannojirimycin (Given Ligand) | CHEMBL494500 (Similar Ligand) |
|---|---|
| OC[C@H]1NC[C@@H](O)C(O)[C@H]1O | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)O[C@H]2CCCOCC2)cc1 |
|
|
|
|
|
|
| 00000000 01000000 00100000 00000400 00380080 00000000 00000000 20000000 00000000 00000080 00200000 50010000 00000002 02800000 00280000 00080008 10000000 00000000 01c02000 00000201 00000000 10000010 07000080 00000010 00000001 00000000 00000000 10000000 00000000 00040000 00000000 00000a00 | 00000050 01c05408 2110010a 01b10700 002810c0 00028000 02000000 a0000004 00540a00 014809e0 08342000 60018000 00008002 00a00101 81e80001 001a1008 10822000 02080000 11402800 01027603 80000120 18280c90 03100040 d9500058 02000400 8000100e 00800000 1020008c 04000600 2006001b 80000000 00012670 |