On Target RT_HIV1 0.36448598/CHEMBL4225004
For the given ligand Tipranavir, we have found in our database that, being scored 0.36448598, the most similar ligand is CHEMBL4225004. Check out the elaboration below.
| Tipranavir (Given Ligand) | CHEMBL4225004 (Similar Ligand) |
|---|---|
| CCC[C@@]4(CCc1ccccc1)C/C(O)=C([C@H](CC)c3cccc(NS(=O)(=O)c2ccc(C(F)(F)F)cn2)c3)\C(=O)O4 | C=C(C)[C@@H]1CC[C@]2(CNCCc3ccc(S(N)(=O)=O)cc3)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC=C(c6ccc(C(=O)O)cc6)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12 |
|
|
|
|
|
|
| 0005005a 01001008 01104942 10b10310 000c1048 00e00000 82000e81 08001402 01400800 01980850 48902204 60009000 84068c00 02a00803 80281444 000e120c 00822420 02100004 21652018 0100e801 e0000120 18208a80 2184a060 08400018 00241c82 90000400 08406020 9000002c 00404602 2006001a 24120000 00010670 | 00000010 01801800 01100302 40b50600 00000008 00004000 80000080 20000402 00000980 001808c0 08302000 60018800 00028002 00200001 80200402 00080008 00000400 02000020 02012000 00002201 81000100 18260a30 00008020 8950001c 01200000 80000000 00406000 d0000028 04400002 21060002 e4020000 00012620 |