On Target RT_HIV1 0.26136363/CHEMBL3977507
For the given ligand Letermovir, we have found in our database that, being scored 0.26136363, the most similar ligand is CHEMBL3977507. Check out the elaboration below.
| Letermovir (Given Ligand) | CHEMBL3977507 (Similar Ligand) |
|---|---|
| COc5cccc(N4CCN(/C2=N/c1c(F)cccc1[C@H](CC(=O)O)N2c3cc(C(F)(F)F)ccc3OC)CC4)c5 | COC(=O)N[C@H](C(=O)NCc1ccc(C(CO)N(Cc2cccnc2OC)S(=O)(=O)c2ccc3scnc3c2)s1)C(c1ccccc1)c1ccccc1 |
|
|
|
|
|
|
| 00004046 80000018 60100128 06010e00 a0021000 00100010 02042404 03003001 00000e00 000a2a52 19300004 5401d224 0c00b882 49003008 010200e1 00184098 00054c90 0e400004 09c00058 00022411 50122100 3a01aa00 230302f0 02438012 009d2802 88000001 e0020400 90000881 08508390 0086a022 001c0420 e5024700 | 1003005a 1180b618 23184108 05b10611 900c10c0 00038100 04014081 2300f40e 00c60bc0 005918c0 09302a04 f000b880 8e008832 00c02021 a12425c1 001e260c 18423010 0219208c 00700018 0002620d e0021980 78298e90 23900000 db410058 42040800 ec010006 c8100800 d008202c 0c600780 2006000f a4004000 84c107e0 |