On Target NS5B_HCV1A 0.32312927/CHEMBL3644920
For the given ligand Letermovir, we have found in our database that, being scored 0.32312927, the most similar ligand is CHEMBL3644920. Check out the elaboration below.
| Letermovir (Given Ligand) | CHEMBL3644920 (Similar Ligand) |
|---|---|
| COc5cccc(N4CCN(/C2=N/c1c(F)cccc1[C@H](CC(=O)O)N2c3cc(C(F)(F)F)ccc3OC)CC4)c5 | C=C[C@@H]1C[C@]1(NC(=O)[C@@H]1CN(c2ccc(-c3ccc(OC)cc3)cc2)CN1C(=O)[C@@H](NC(=O)OC1CCCC1)C(C)(C)C)C(=O)NS(=O)(=O)C1CC1 |
|
|
|
|
|
|
| 00004046 80000018 60100128 06010e00 a0021000 00100010 02042404 03003001 00000e00 000a2a52 19300004 5401d224 0c00b882 49003008 010200e1 00184098 00054c90 0e400004 09c00058 00022411 50122100 3a01aa00 230302f0 02438012 009d2802 88000001 e0020400 90000881 08508390 0086a022 001c0420 e5024700 | 00016086 0d403c08 20100128 05310f00 20081000 00018000 020e0004 a0003409 10800200 00528be8 00202404 5001b000 0e00f012 0104a101 81420441 001a8008 02864010 02482000 4c610850 00024a01 60100100 bc070e10 31020003 3244003a 02112000 80001002 00020000 902000ec 0800c200 81060093 a4184000 01016270 |