On Target NS5B_HCV1A 0.42600897/CHEMBL3644927
For the given ligand Amprenavir, we have found in our database that, being scored 0.42600897, the most similar ligand is CHEMBL3644927. Check out the elaboration below.
| Amprenavir (Given Ligand) | CHEMBL3644927 (Similar Ligand) |
|---|---|
| CC(C)CN(C[C@@H](O)[C@H](Cc1ccccc1)NC(=O)O[C@H]2CCOC2)S(=O)(=O)c3ccc(N)cc3 | CCC[C@H](NC(=O)[C@@H]1CN(S(=O)(=O)c2ccc(Br)cc2)CN1C(=O)[C@@H](NC(=O)OC1CCCC1)C(C)(C)C)C(=O)C(=O)NC1CC1 |
|
|
|
|
|
|
| 00000012 01c07401 0110050a 01b10600 00080090 00028000 00000000 20000044 00542a00 014809e0 08302004 60018010 00008002 00200101 80e80040 001a0008 10022000 02080000 01400800 01007603 c0000100 18280c90 27100040 d9500058 02000400 8000100e 00000000 1020006c 04000600 2006001b 80000000 00012670 | 00014090 01c0b400 01300100 07b10f00 00080000 00018000 08024004 a0002008 04800200 0042a9e2 00202010 e001b400 0e00b01a 01002141 80a00000 001a8008 00826014 00082001 00602850 00007603 80002100 380d0e10 01002003 3a500038 02013000 0002100e c0020000 1020042c 08800600 21060013 a018402a 08012260 |