On Target NS5B_HCV1A 0.254717/CHEMBL163917
For the given ligand 1-deoxymannojirimycin, we have found in our database that, being scored 0.254717, the most similar ligand is CHEMBL163917. Check out the elaboration below.
| 1-deoxymannojirimycin (Given Ligand) | CHEMBL163917 (Similar Ligand) |
|---|---|
| OC[C@H]1NC[C@@H](O)C(O)[C@H]1O | CC(C)C[C@H](NC(=O)[C@H](CCC(=O)O)NC(=O)OC(C)(C)C)C(=O)N[C@@H](CC(F)F)C(=O)C(=O)O |
|
|
|
|
|
|
| 00000000 01000000 00100000 00000400 00380080 00000000 00000000 20000000 00000000 00000080 00200000 50010000 00000002 02800000 00280000 00080008 10000000 00000000 01c02000 00000201 00000000 10000010 07000080 00000010 00000001 00000000 00000000 10000000 00000000 00040000 00000000 00000a00 | 00030000 01403000 00100000 04000600 00181000 00018000 00000000 20000008 04800200 00020080 00200000 4001f000 0e008032 01002001 80000000 001a0408 000a0000 00080001 00c00810 00000201 00000000 30140e50 01000083 02100018 00001001 00000082 00000060 90200020 08000200 02040001 a0004000 00802a00 |