On Target NS5B_HCV1B 0.12173913/CHEMBL3422106
For the given ligand 1-deoxymannojirimycin, we have found in our database that, being scored 0.12173913, the most similar ligand is CHEMBL3422106. Check out the elaboration below.
| 1-deoxymannojirimycin (Given Ligand) | CHEMBL3422106 (Similar Ligand) |
|---|---|
| OC[C@H]1NC[C@@H](O)C(O)[C@H]1O | CC(C)N1CCC(N(C)C(=O)Cn2c(-c3ccccc3)c(C3CCCCC3)c3sc(C(=O)O)cc32)C1 |
|
|
|
|
|
|
| 00000000 01000000 00100000 00000400 00380080 00000000 00000000 20000000 00000000 00000080 00200000 50010000 00000002 02800000 00280000 00080008 10000000 00000000 01c02000 00000201 00000000 10000010 07000080 00000010 00000001 00000000 00000000 10000000 00000000 00040000 00000000 00000a00 | 000360c2 2d003c01 00100912 55810618 201e5121 0000c110 00002080 2009400c 20600900 100809e0 08300a04 4003a080 8800881a 00e0b801 204a3d20 0c0c000c 11134000 c280209c 06202400 00514213 00102100 788e8ef0 30904083 9250001e 0a842001 c4000009 08010000 90000044 0a044c06 00061453 c0020a40 00c11e20 |