On Target NSP15_SARS 0.19844358/CHEMBL2441741
For the given ligand Letermovir, we have found in our database that, being scored 0.19844358, the most similar ligand is CHEMBL2441741. Check out the elaboration below.
| Letermovir (Given Ligand) | CHEMBL2441741 (Similar Ligand) |
|---|---|
| COc5cccc(N4CCN(/C2=N/c1c(F)cccc1[C@H](CC(=O)O)N2c3cc(C(F)(F)F)ccc3OC)CC4)c5 | CC(C)C[C@H](NC(=O)[C@H](Cc1cccc2ccccc12)NC(=O)OCc1ccccc1)C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O |
|
|
|
|
|
|
| 00004046 80000018 60100128 06010e00 a0021000 00100010 02042404 03003001 00000e00 000a2a52 19300004 5401d224 0c00b882 49003008 010200e1 00184098 00054c90 0e400004 09c00058 00022411 50122100 3a01aa00 230302f0 02438012 009d2802 88000001 e0020400 90000881 08508390 0086a022 001c0420 e5024700 | 01030000 01403200 00100100 04010600 00000000 0001c010 00000000 2000000c 00e00b00 000a08c0 08300000 4003b000 0e00801a 00012001 80000000 021e0008 00020000 02080400 00002898 00000201 00000100 38240e38 00000003 83500018 00000800 80002002 00000000 10200020 0c000200 0006000b e0004000 00802600 |