On Target NSP15_SARS 0.37823835/CHEMBL2441745
For the given ligand Amprenavir, we have found in our database that, being scored 0.37823835, the most similar ligand is CHEMBL2441745. Check out the elaboration below.
| Amprenavir (Given Ligand) | CHEMBL2441745 (Similar Ligand) |
|---|---|
| CC(C)CN(C[C@@H](O)[C@H](Cc1ccccc1)NC(=O)O[C@H]2CCOC2)S(=O)(=O)c3ccc(N)cc3 | CC(C)C[C@H](NC(=O)[C@H](Cc1cccc2ccccc12)NC(=O)OCc1ccccc1)C(=O)N[C@@H](C[C@@H]1CCNC1=O)C(=O)C(=O)NC(C)C |
|
|
|
|
|
|
| 00000012 01c07401 0110050a 01b10600 00080090 00028000 00000000 20000044 00542a00 014809e0 08302004 60018010 00008002 00200101 80e80040 001a0008 10022000 02080000 01400800 01007603 c0000100 18280c90 27100040 d9500058 02000400 8000100e 00000000 1020006c 04000600 2006001b 80000000 00012670 | 01030000 01403600 00100100 04010600 00000000 0001c010 00000000 2000000c 04e00b00 000a09e0 08300000 4003b000 0e00801a 00012001 80000000 021e0008 00020000 02080401 00002898 00000201 00000100 382c0e38 00000003 83500018 00001800 80002002 00000000 10200020 0c000200 0006001b e0024000 00802600 |