On Target NP_HCoV-OC43 0.15789473/CHEMBL3233481
For the given ligand Etravirine, we have found in our database that, being scored 0.15789473, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| Etravirine (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| Cc1cc(C#N)cc(C)c1Oc3nc(Nc2ccc(C#N)cc2)nc(N)c3Br | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 0200c402 80008838 2000010a 08090600 82001029 00804000 0a04a400 00000808 80000104 80800850 00200004 41009040 00000106 08008001 81800041 001c200c 00460000 92004008 08e02000 10a66000 414a0200 0c000800 20800c40 00502000 00004000 80000000 00020000 102100c0 00008328 00460c00 40025408 082800c0 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |