On Target NS3_HCV1A 0.37176472/CHEMBL3921348
For the given ligand Glecaprevir, we have found in our database that, being scored 0.37176472, the most similar ligand is CHEMBL3921348. Check out the elaboration below.
| Glecaprevir (Given Ligand) | CHEMBL3921348 (Similar Ligand) |
|---|---|
| CC(C)(C)[C@@H]7NC(=O)O[C@@H]1CCC[C@H]1OC/C=C/C(F)(F)c3nc2ccccc2nc3O[C@@H]6C[C@@H](C(=O)N[C@]5(C(=O)NS(=O)(=O)C4(C)CC4)C[C@H]5C(F)F)N(C6)C7=O | CNC(=O)c1c(-c2ccc(F)cc2)oc2cc(N(C)S(C)(=O)=O)c(-c3ccc4c(n3)-c3cc5c(F)cccc5n3C(CNC(=O)[C@@H]3CCCN3C(=O)OC)O4)cc12 |
|
|
|
|
|
|
| 0405208a 0f407019 44100508 15391712 801c18e0 86818914 0202a803 a0609648 10c52200 00d888f0 44a4a404 4085b010 0e00c812 0b442143 f1fe1140 021eb40c 1aaa0020 220a8100 20e08c10 00004201 50020060 bc148e30 37a08083 7a168038 02241403 4000d48a 08c08260 9020006d 08000304 07060803 a4044000 25012a70 | 0c416202 01207c29 6218490a 56310e02 2b8412e1 0601c134 00ad0412 62b83248 04e74340 702008d0 8421a124 4035b410 ce808c17 08683081 e13a5860 221e200d 10264000 120ba804 0e200210 14524227 403e0000 3a068e7e f3800023 8258c01c 0900248c c0014002 34c24654 988410ef 0844e31c 11278451 e0145e40 00010260 |