On Target NS3_HCV1A 0.28467155/CHEMBL3696817
For the given ligand Fosamprenavir, we have found in our database that, being scored 0.28467155, the most similar ligand is CHEMBL3696817. Check out the elaboration below.
| Fosamprenavir (Given Ligand) | CHEMBL3696817 (Similar Ligand) |
|---|---|
| CC(C)CN(C[C@@H](OP(=O)(O)O)[C@H](Cc1ccccc1)NC(=O)O[C@H]2CCOC2)S(=O)(=O)c3ccc(N)cc3 | COc1nc(N)nc2c1ncn2[C@@H]1O[C@@H]2COP(=O)(OC(C)C)O[C@H]2[C@@]1(C)N |
|
|
|
|
|
|
| 00000012 01c07401 0110050a 01b10600 00080094 00028000 00004080 20000044 00542a00 014809e0 08302004 e0018010 00008002 00220121 80ea0040 001a0608 100e20a0 02080000 01400800 01007603 c0000100 1c280c90 27100040 d9500058 02004400 8000100e 02000000 3021006c 04000600 2006001f 80420000 0001a670 | 0000400a 01c01818 60080318 c1810f00 80180064 0008c004 1400ec41 80403808 00404100 818000f0 0c00900c 40059000 00001104 0b8a0120 01881884 101d8e0c 002e0020 00800008 39c00000 00247003 800a0020 3c000850 27800840 08400814 18000c40 40000202 0e060200 10010060 00000208 0046101c d1e84000 08298080 |