On Target NS3_HCV1B 0.42133334/CHEMBL297884
For the given ligand Glecaprevir, we have found in our database that, being scored 0.42133334, the most similar ligand is CHEMBL297884. Check out the elaboration below.
| Glecaprevir (Given Ligand) | CHEMBL297884 (Similar Ligand) |
|---|---|
| CC(C)(C)[C@@H]7NC(=O)O[C@@H]1CCC[C@H]1OC/C=C/C(F)(F)c3nc2ccccc2nc3O[C@@H]6C[C@@H](C(=O)N[C@]5(C(=O)NS(=O)(=O)C4(C)CC4)C[C@H]5C(F)F)N(C6)C7=O | COc1ccc2c(O[C@@H]3C[C@H]4C(=O)N[C@]5(C(=O)O)C[C@H]5/C=C\CCCCC[C@H](NC(=O)OC5CCCC5)C(=O)N4C3)cc(-c3csc(NC(C)C)n3)nc2c1 |
|
|
|
|
|
|
| 0405208a 0f407019 44100508 15391712 801c18e0 86818914 0202a803 a0609648 10c52200 00d888f0 44a4a404 4085b010 0e00c812 0b442143 f1fe1140 021eb40c 1aaa0020 220a8100 20e08c10 00004201 50020060 bc148e30 37a08083 7a168038 02241403 4000d48a 08c08260 9020006d 08000304 07060803 a4044000 25012a70 | 04072002 c9427008 a0104908 14810702 211c10a0 02118050 c6080100 b00a848a 10800300 2010c8ca 00202a04 5101b420 0e82881a 01502183 911a3441 021e200c 10a24000 120861c4 44e82818 12e63a01 40080000 3914aef8 f390c883 82510018 00a01081 8c101002 00e04240 90200465 0c00420c 850e2403 e4065800 04252a42 |