On Target PA_INFA 0.2900433/CHEMBL2040640
For the given ligand Fosamprenavir, we have found in our database that, being scored 0.2900433, the most similar ligand is CHEMBL2040640. Check out the elaboration below.
| Fosamprenavir (Given Ligand) | CHEMBL2040640 (Similar Ligand) |
|---|---|
| CC(C)CN(C[C@@H](OP(=O)(O)O)[C@H](Cc1ccccc1)NC(=O)O[C@H]2CCOC2)S(=O)(=O)c3ccc(N)cc3 | O=C(O)/C(O)=C/C(=O)C1(Cc2ccc(Cl)cc2)CCCN(S(=O)(=O)Cc2ccccc2)C1 |
|
|
|
|
|
|
| 00000012 01c07401 0110050a 01b10600 00080094 00028000 00004080 20000044 00542a00 014809e0 08302004 e0018010 00008002 00220121 80ea0040 001a0608 100e20a0 02080000 01400800 01007603 c0000100 1c280c90 27100040 d9500058 02004400 8000100e 02000000 3021006c 04000600 2006001f 80420000 0001a670 | 00018000 05000220 00102102 01310600 00000000 00000000 00000084 28008400 11000800 007808c4 08302418 5001d800 8e029036 00240001 80400400 000c0008 0000400c 02000100 00252018 00004a01 80000100 1c800b90 04008000 10500030 02003800 80002400 00444000 9000000c 04004002 0006008a 24000000 00032670 |