On Target PR_HIV1 0.26223776/CHEMBL450294
For the given ligand Pibrentasvir, we have found in our database that, being scored 0.26223776, the most similar ligand is CHEMBL450294. Check out the elaboration below.
| Pibrentasvir (Given Ligand) | CHEMBL450294 (Similar Ligand) |
|---|---|
| COC(=O)N[C@H](C(=O)N1CCC[C@H]1c%10nc9cc([C@H]5CC[C@H](c4cc3nc([C@@H]2CCCN2C(=O)[C@@H](NC(=O)OC)[C@@H](C)OC)[nH]c3cc4F)N5c8cc(F)c(N7CCC(c6ccc(F)cc6)CC7)c(F)c8)c(F)cc9[nH]%10)[C@@H](C)OC | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)OC2COCCN(C)CCOC2)cc1 |
|
|
|
|
|
|
| 0000408a 0100fa00 00100f02 56050e00 200402e0 0033e030 01000000 22003009 04900b00 004948c0 09318004 f081f000 1c018802 0060b000 00021440 021e010d 03262608 06080086 08a02018 05100a01 40300102 38078e30 338100a1 22500018 01106001 c0000002 00800840 900000a3 08408306 00c7880b e004c000 200066a0 | 00000010 01c05409 2110050a 81b10600 000810c0 00028000 02000000 20000044 00542a00 014809e0 08302000 60018010 00008002 00200001 81e81009 001b0008 10022000 02080000 01400800 01027603 80000120 18280c90 17100040 d9500058 12000400 8000000e 00800000 102000ed 04000600 20060013 80000000 00012670 |