On Target PR_HIV1 0.18604651/CHEMBL492666
For the given ligand Doravirine, we have found in our database that, being scored 0.18604651, the most similar ligand is CHEMBL492666. Check out the elaboration below.
| Doravirine (Given Ligand) | CHEMBL492666 (Similar Ligand) |
|---|---|
| Cn3c(Cn2ccc(C(F)(F)F)c(Oc1cc(Cl)cc(C#N)c1)c2=O)n[nH]c3=O | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)OC2CCCCCC2)cc1 |
|
|
|
|
|
|
| 00008002 40020c08 60104108 00010601 81041038 00000044 968c0c00 00200401 06008104 408008f0 04010124 44858800 82008806 0a600002 81120001 010e200c 00408400 02808020 20e82100 00260200 50400000 18018110 e1800c80 0272a080 00006440 c0004400 00600020 d02a0010 00008384 00060600 80620480 00021220 | 00000010 01c05408 2110010a 01b10700 00081080 00028000 02000000 a0000004 00540a00 004809e0 08302000 60018000 00008002 00a00101 81e80001 001a0008 10822000 02080000 00402800 01027603 80000100 18280c90 03100040 d9500058 02000000 8000100e 00800000 1020108c 04000600 20060013 80020000 00012670 |