On Target RT_HIV1 0.29663607/CHEMBL4109767
For the given ligand Raltegravir, we have found in our database that, being scored 0.29663607, the most similar ligand is CHEMBL4109767. Check out the elaboration below.
| Raltegravir (Given Ligand) | CHEMBL4109767 (Similar Ligand) |
|---|---|
| Cc3nnc(C(=O)NC(C)(C)c2nc(C(=O)NCc1ccc(F)cc1)c(O)c(=O)n2C)o3 | COC(=O)N[C@H](C(=O)NCc1ccc([C@@H](CO)N(Cc2cc3cccnc3[nH]2)S(=O)(=O)c2ccc(N)cc2)s1)C(c1ccccc1)c1ccccc1 |
|
|
|
|
|
|
| 0001000a 01801808 40182100 12050e00 01080028 0012c016 00801c00 0a443407 06004900 401008e0 0839807c 40809800 04009802 00709008 00020480 000c250c 0000a008 02808523 80400000 003608c1 80000001 1805a600 21804041 4070051c 00504810 c0000680 24100070 90071001 00006185 0446c001 c46c8000 6080e3a0 | 0001001a 0080b200 03184100 15b10e01 100c00f0 0013c000 04000081 2b00700f 00c60b00 004938c0 09b12204 e000b880 8c008812 00d02021 b0262440 021e030c 18423000 0219000e 82700018 0000620d c0001900 78288eb0 23900000 cb400158 42100800 e4010406 40300800 d000206c 0c600784 2046000f e0044200 00c147e0 |