On Target RT_HIV1 0.3667622/CHEMBL3683705
For the given ligand Glecaprevir, we have found in our database that, being scored 0.3667622, the most similar ligand is CHEMBL3683705. Check out the elaboration below.
| Glecaprevir (Given Ligand) | CHEMBL3683705 (Similar Ligand) |
|---|---|
| CC(C)(C)[C@@H]7NC(=O)O[C@@H]1CCC[C@H]1OC/C=C/C(F)(F)c3nc2ccccc2nc3O[C@@H]6C[C@@H](C(=O)N[C@]5(C(=O)NS(=O)(=O)C4(C)CC4)C[C@H]5C(F)F)N(C6)C7=O | COC(=O)N[C@H](C(=O)NCC(F)(F)CC[C@@H](CO)N(Cc1cn[nH]c1)S(=O)(=O)c1ccc2ncsc2c1)C(c1ccccc1)c1ccccc1 |
|
|
|
|
|
|
| 0405208a 0f407019 44100508 15391712 801c18e0 86818914 0202a803 a0609648 10c52200 00d888f0 44a4a404 4085b010 0e00c812 0b442143 f1fe1140 021eb40c 1aaa0020 220a8100 20e08c10 00004201 50020060 bc148e30 37a08083 7a168038 02241403 4000d48a 08c08260 9020006d 08000304 07060803 a4044000 25012a70 | 0003001a 5d803208 21100188 05b10610 000c1080 0001a0c0 04004801 2100900c 00c40a80 804818c0 08302a04 7001b000 0c20a022 00c42001 806024c0 001e140c 10022020 02080080 00602018 00226e01 c0000100 78240eb0 23900a01 db750058 02000800 ac000106 c0000020 d000002c 0c001680 2606000b a0004000 00412670 |