On Target NS5B_HCV1B 0.30585107/CHEMBL3645214
For the given ligand Glecaprevir, we have found in our database that, being scored 0.30585107, the most similar ligand is CHEMBL3645214. Check out the elaboration below.
| Glecaprevir (Given Ligand) | CHEMBL3645214 (Similar Ligand) |
|---|---|
| CC(C)(C)[C@@H]7NC(=O)O[C@@H]1CCC[C@H]1OC/C=C/C(F)(F)c3nc2ccccc2nc3O[C@@H]6C[C@@H](C(=O)N[C@]5(C(=O)NS(=O)(=O)C4(C)CC4)C[C@H]5C(F)F)N(C6)C7=O | CNC(=O)c1c2cc(C3CC3)c(N(CCCNC(=O)C3CCOC3)S(C)(=O)=O)cc2nn1-c1ccc(Nc2ccc(F)cc2)cc1 |
|
|
|
|
|
|
| 0405208a 0f407019 44100508 15391712 801c18e0 86818914 0202a803 a0609648 10c52200 00d888f0 44a4a404 4085b010 0e00c812 0b442143 f1fe1140 021eb40c 1aaa0020 220a8100 20e08c10 00004201 50020060 bc148e30 37a08083 7a168038 02241403 4000d48a 08c08260 9020006d 08000304 07060803 a4044000 25012a70 | 00044006 00805e08 20180902 43390f00 211c0000 00204052 02040010 2200140c 00102900 004909e0 09312024 40119800 94008c23 01481201 808a0040 000e200e 04268000 02000104 08e0000a 00225203 e0100121 1c8f8e38 21800880 9360001c 02104481 c0000048 02270280 9000108d 0c488304 0046805b c4048080 a0116fe0 |