On Target NS5B_HCV1B 0.30514705/CHEMBL3645208
For the given ligand Doravirine, we have found in our database that, being scored 0.30514705, the most similar ligand is CHEMBL3645208. Check out the elaboration below.
| Doravirine (Given Ligand) | CHEMBL3645208 (Similar Ligand) |
|---|---|
| Cn3c(Cn2ccc(C(F)(F)F)c(Oc1cc(Cl)cc(C#N)c1)c2=O)n[nH]c3=O | CNC(=O)c1c2cc(C3CC3)c(N(CCCO)S(C)(=O)=O)cc2nn1-c1ccc(Cl)cc1 |
|
|
|
|
|
|
| 00008002 40020c08 60104108 00010601 81041038 00000044 968c0c00 00200401 06008104 408008f0 04010124 44858800 82008806 0a600002 81120001 010e200c 00408400 02808020 20e82100 00260200 50400000 18018110 e1800c80 0272a080 00006440 c0004400 00600020 d02a0010 00008384 00060600 80620480 00021220 | 0000c006 00805e08 20180902 41310e00 210c0000 00004042 02040000 02001408 00100900 004908c0 09312024 40118800 82008c27 01400201 810a0040 000e200e 04268000 02400604 08e00008 00224205 c0100101 1c838f38 21800880 9360001c 02106080 c0000040 002f0080 8000108c 0c488104 0046004b c4048080 a01347e0 |