On Target NSP15_SARS 0.26517573/CHEMBL2441745
For the given ligand Glecaprevir, we have found in our database that, being scored 0.26517573, the most similar ligand is CHEMBL2441745. Check out the elaboration below.
| Glecaprevir (Given Ligand) | CHEMBL2441745 (Similar Ligand) |
|---|---|
| CC(C)(C)[C@@H]7NC(=O)O[C@@H]1CCC[C@H]1OC/C=C/C(F)(F)c3nc2ccccc2nc3O[C@@H]6C[C@@H](C(=O)N[C@]5(C(=O)NS(=O)(=O)C4(C)CC4)C[C@H]5C(F)F)N(C6)C7=O | CC(C)C[C@H](NC(=O)[C@H](Cc1cccc2ccccc12)NC(=O)OCc1ccccc1)C(=O)N[C@@H](C[C@@H]1CCNC1=O)C(=O)C(=O)NC(C)C |
|
|
|
|
|
|
| 0405208a 0f407019 44100508 15391712 801c18e0 86818914 0202a803 a0609648 10c52200 00d888f0 44a4a404 4085b010 0e00c812 0b442143 f1fe1140 021eb40c 1aaa0020 220a8100 20e08c10 00004201 50020060 bc148e30 37a08083 7a168038 02241403 4000d48a 08c08260 9020006d 08000304 07060803 a4044000 25012a70 | 01030000 01403600 00100100 04010600 00000000 0001c010 00000000 2000000c 04e00b00 000a09e0 08300000 4003b000 0e00801a 00012001 80000000 021e0008 00020000 02080401 00002898 00000201 00000100 382c0e38 00000003 83500018 00001800 80002002 00000000 10200020 0c000200 0006001b e0024000 00802600 |