On Target NP_HCoV-OC43 0.15765765/CHEMBL3233481
For the given ligand Raltegravir, we have found in our database that, being scored 0.15765765, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| Raltegravir (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| Cc3nnc(C(=O)NC(C)(C)c2nc(C(=O)NCc1ccc(F)cc1)c(O)c(=O)n2C)o3 | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 0001000a 01801808 40182100 12050e00 01080028 0012c016 00801c00 0a443407 06004900 401008e0 0839807c 40809800 04009802 00709008 00020480 000c250c 0000a008 02808523 80400000 003608c1 80000001 1805a600 21804041 4070051c 00504810 c0000680 24100070 90071001 00006185 0446c001 c46c8000 6080e3a0 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |