On Target NP_HCoV-OC43 0.19736843/CHEMBL3233481
For the given ligand Pibrentasvir, we have found in our database that, being scored 0.19736843, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| Pibrentasvir (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| COC(=O)N[C@H](C(=O)N1CCC[C@H]1c%10nc9cc([C@H]5CC[C@H](c4cc3nc([C@@H]2CCCN2C(=O)[C@@H](NC(=O)OC)[C@@H](C)OC)[nH]c3cc4F)N5c8cc(F)c(N7CCC(c6ccc(F)cc6)CC7)c(F)c8)c(F)cc9[nH]%10)[C@@H](C)OC | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 0000408a 0100fa00 00100f02 56050e00 200402e0 0033e030 01000000 22003009 04900b00 004948c0 09318004 f081f000 1c018802 0060b000 00021440 021e010d 03262608 06080086 08a02018 05100a01 40300102 38078e30 338100a1 22500018 01106001 c0000002 00800840 900000a3 08408306 00c7880b e004c000 200066a0 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |