On Target PLP_SARS 0.2792793/CHEMBL213054
For the given ligand Fosamprenavir, we have found in our database that, being scored 0.2792793, the most similar ligand is CHEMBL213054. Check out the elaboration below.
| Fosamprenavir (Given Ligand) | CHEMBL213054 (Similar Ligand) |
|---|---|
| CC(C)CN(C[C@@H](OP(=O)(O)O)[C@H](Cc1ccccc1)NC(=O)O[C@H]2CCOC2)S(=O)(=O)c3ccc(N)cc3 | CC(OC(C)(C)C)[C@H](NC(=O)OCc1ccccc1)C(=O)N[C@@H](CC1CCCCC1)C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O |
|
|
|
|
|
|
| 00000012 01c07401 0110050a 01b10600 00080094 00028000 00004080 20000044 00542a00 014809e0 08302004 e0018010 00008002 00220121 80ea0040 001a0608 100e20a0 02080000 01400800 01007603 c0000100 1c280c90 27100040 d9500058 02004400 8000100e 02000000 3021006c 04000600 2006001f 80420000 0001a670 | 01030000 01407000 00100100 84010600 00040080 0023c010 00000000 20000008 00a00300 000208c0 00200000 4003b000 1e00801a 00092001 80001008 021a0008 00220000 02080400 02802890 01000201 00000020 38040e30 13000083 02500018 00000401 80002002 00800800 10200020 08000200 00060001 e0024000 00802200 |