On Target PLP_SARS 0.30653265/CHEMBL222735
For the given ligand Doravirine, we have found in our database that, being scored 0.30653265, the most similar ligand is CHEMBL222735. Check out the elaboration below.
| Doravirine (Given Ligand) | CHEMBL222735 (Similar Ligand) |
|---|---|
| Cn3c(Cn2ccc(C(F)(F)F)c(Oc1cc(Cl)cc(C#N)c1)c2=O)n[nH]c3=O | COc1cccc(C(=O)Oc2cncc(Cl)c2)c1 |
|
|
|
|
|
|
| 00008002 40020c08 60104108 00010601 81041038 00000044 968c0c00 00200401 06008104 408008f0 04010124 44858800 82008806 0a600002 81120001 010e200c 00408400 02808020 20e82100 00260200 50400000 18018110 e1800c80 0272a080 00006440 c0004400 00600020 d02a0010 00008384 00060600 80620480 00021220 | 04008002 48000808 60004108 00010200 00041000 04004004 82080000 01200000 00000100 00000848 00000004 40048800 0680880e 08010002 01034007 220c000c 00020000 02002000 00280008 00020200 40000000 08028b20 30800000 00c09004 00002c00 80082200 00000200 00000000 00000200 00020000 c0000000 10020000 |