On Target NSP1_SARS 0.21621622/CHEMBL2441745
For the given ligand Raltegravir, we have found in our database that, being scored 0.21621622, the most similar ligand is CHEMBL2441745. Check out the elaboration below.
| Raltegravir (Given Ligand) | CHEMBL2441745 (Similar Ligand) |
|---|---|
| Cc3nnc(C(=O)NC(C)(C)c2nc(C(=O)NCc1ccc(F)cc1)c(O)c(=O)n2C)o3 | CC(C)C[C@H](NC(=O)[C@H](Cc1cccc2ccccc12)NC(=O)OCc1ccccc1)C(=O)N[C@@H](C[C@@H]1CCNC1=O)C(=O)C(=O)NC(C)C |
|
|
|
|
|
|
| 0001000a 01801808 40182100 12050e00 01080028 0012c016 00801c00 0a443407 06004900 401008e0 0839807c 40809800 04009802 00709008 00020480 000c250c 0000a008 02808523 80400000 003608c1 80000001 1805a600 21804041 4070051c 00504810 c0000680 24100070 90071001 00006185 0446c001 c46c8000 6080e3a0 | 01030000 01403600 00100100 04010600 00000000 0001c010 00000000 2000000c 04e00b00 000a09e0 08300000 4003b000 0e00801a 00012001 80000000 021e0008 00020000 02080401 00002898 00000201 00000100 382c0e38 00000003 83500018 00001800 80002002 00000000 10200020 0c000200 0006001b e0024000 00802600 |