On Target NSP1_SARS 0.3586498/CHEMBL2441741
For the given ligand Pibrentasvir, we have found in our database that, being scored 0.3586498, the most similar ligand is CHEMBL2441741. Check out the elaboration below.
| Pibrentasvir (Given Ligand) | CHEMBL2441741 (Similar Ligand) |
|---|---|
| COC(=O)N[C@H](C(=O)N1CCC[C@H]1c%10nc9cc([C@H]5CC[C@H](c4cc3nc([C@@H]2CCCN2C(=O)[C@@H](NC(=O)OC)[C@@H](C)OC)[nH]c3cc4F)N5c8cc(F)c(N7CCC(c6ccc(F)cc6)CC7)c(F)c8)c(F)cc9[nH]%10)[C@@H](C)OC | CC(C)C[C@H](NC(=O)[C@H](Cc1cccc2ccccc12)NC(=O)OCc1ccccc1)C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O |
|
|
|
|
|
|
| 0000408a 0100fa00 00100f02 56050e00 200402e0 0033e030 01000000 22003009 04900b00 004948c0 09318004 f081f000 1c018802 0060b000 00021440 021e010d 03262608 06080086 08a02018 05100a01 40300102 38078e30 338100a1 22500018 01106001 c0000002 00800840 900000a3 08408306 00c7880b e004c000 200066a0 | 01030000 01403200 00100100 04010600 00000000 0001c010 00000000 2000000c 00e00b00 000a08c0 08300000 4003b000 0e00801a 00012001 80000000 021e0008 00020000 02080400 00002898 00000201 00000100 38240e38 00000003 83500018 00000800 80002002 00000000 10200020 0c000200 0006000b e0004000 00802600 |