On Target NS3_HCV1B 0.21428572/CHEMBL3954962
For the given ligand Trifluridine, we have found in our database that, being scored 0.21428572, the most similar ligand is CHEMBL3954962. Check out the elaboration below.
| Trifluridine (Given Ligand) | CHEMBL3954962 (Similar Ligand) |
|---|---|
| O=c2[nH]c(=O)n([C@H]1C[C@H](O)[C@@H](CO)O1)cc2C(F)(F)F | C=CC(=O)NC[C@H](NC(=O)[C@@H](NC(=O)c1cnccn1)C1CCCCC1)C(=O)N1C[C@@H]2CCC[C@@H]2[C@H]1C(=O)N[C@@H](CCC)C(OC(=O)C(F)(F)F)C(=O)NC1CC1 |
|
|
|
|
|
|
| 08000002 01400000 00100000 92010610 00180062 00004140 00000c00 00000000 06000100 818000b0 0c00000c 40018000 00009000 0bc80110 00a81080 001c800c 00200120 82008000 09c00000 40001001 84080020 10000010 25800041 08300410 10040404 c0000002 20000200 90040060 00004200 01460000 40280004 00000280 | 10018002 01807400 00100b00 94010f10 000800c0 00100010 0000c00c 20003409 11000000 000101a0 01290000 4001f000 0e00801a 01112001 809a1408 000c110c 18860000 82000103 02402010 00001205 80000120 300f8e30 33004003 0250001c 00141400 00000000 08880000 90000005 08000204 01060813 a4024000 82002600 |