On Target PR_HIV1 0.2361111/CHEMBL3645129
For the given ligand Trifluridine, we have found in our database that, being scored 0.2361111, the most similar ligand is CHEMBL3645129. Check out the elaboration below.
| Trifluridine (Given Ligand) | CHEMBL3645129 (Similar Ligand) |
|---|---|
| O=c2[nH]c(=O)n([C@H]1C[C@H](O)[C@@H](CO)O1)cc2C(F)(F)F | CC(C)CN(C[C@@H](O)[C@H](Cc1ccccc1)NC(=O)OC1CC2OCO[C@@H]2C1)S(=O)(=O)c1ccc(CO)cc1 |
|
|
|
|
|
|
| 08000002 01400000 00100000 92010610 00180062 00004140 00000c00 00000000 06000100 818000b0 0c00000c 40018000 00009000 0bc80110 00a81080 001c800c 00200120 82008000 09c00000 40001001 84080020 10000010 25800041 08300410 10040404 c0000002 20000200 90040060 00004200 01460000 40280004 00000280 | 00000010 01c05400 01100102 01b10700 00280088 0002c004 00000800 a8000004 00740b00 014809e0 08302000 60018000 00008002 02200101 80e80000 003a0008 10822000 02080000 11408800 01007603 80000100 18380cb0 07100040 d9500058 02000000 8000100e 00000000 3420002c 04000600 2106001b c0a00000 00012670 |