On Target PR_HIV1 0.17889908/CHEMBL3645129
For the given ligand Entecavir, we have found in our database that, being scored 0.17889908, the most similar ligand is CHEMBL3645129. Check out the elaboration below.
| Entecavir (Given Ligand) | CHEMBL3645129 (Similar Ligand) |
|---|---|
| C=C1[C@H](CO)[C@@H](O)C[C@@H]1n3cnc2c(=O)nc(N)[nH]c23 | CC(C)CN(C[C@@H](O)[C@H](Cc1ccccc1)NC(=O)OC1CC2OCO[C@@H]2C1)S(=O)(=O)c1ccc(CO)cc1 |
|
|
|
|
|
|
| 0000000a 81801800 00080000 00000600 00180060 0000c040 0008b004 00000c00 16400100 809000e8 0000800c 40091000 00009000 01c00000 00080484 100c000c 00000000 00008100 09c12000 00200001 80000100 1c000050 21800840 00700014 00000000 80200000 60000000 80040000 00004008 01461000 e4080000 80000280 | 00000010 01c05400 01100102 01b10700 00280088 0002c004 00000800 a8000004 00740b00 014809e0 08302000 60018000 00008002 02200101 80e80000 003a0008 10822000 02080000 11408800 01007603 80000100 18380cb0 07100040 d9500058 02000000 8000100e 00000000 3420002c 04000600 2106001b c0a00000 00012670 |