On Target RT_HIV1 0.25555557/CHEMBL4227119
For the given ligand Trifluridine, we have found in our database that, being scored 0.25555557, the most similar ligand is CHEMBL4227119. Check out the elaboration below.
| Trifluridine (Given Ligand) | CHEMBL4227119 (Similar Ligand) |
|---|---|
| O=c2[nH]c(=O)n([C@H]1C[C@H](O)[C@@H](CO)O1)cc2C(F)(F)F | C=C(C)[C@@H]1CC[C@]2(CNCCn3ccnc3)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC=C(c6ccc(C(=O)O)cc6)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12 |
|
|
|
|
|
|
| 08000002 01400000 00100000 92010610 00180062 00004140 00000c00 00000000 06000100 818000b0 0c00000c 40018000 00009000 0bc80110 00a81080 001c800c 00200120 82008000 09c00000 40001001 84080020 10000010 25800041 08300410 10040404 c0000002 20000200 90040060 00004200 01460000 40280004 00000280 | 00000002 01000c00 00100302 40050600 00180040 00004000 80000080 20000402 00200900 001808c0 08309008 40018800 00029002 01200000 00000c82 000c000c 00000400 02000020 02412000 00000201 81000100 38020a30 21008021 02500014 01200000 80000000 00406000 d0000000 08400002 01460012 e40a0000 00000e00 |