On Target NS5B_HCV1B 0.21509434/CHEMBL3645211
For the given ligand Trifluridine, we have found in our database that, being scored 0.21509434, the most similar ligand is CHEMBL3645211. Check out the elaboration below.
| Trifluridine (Given Ligand) | CHEMBL3645211 (Similar Ligand) |
|---|---|
| O=c2[nH]c(=O)n([C@H]1C[C@H](O)[C@@H](CO)O1)cc2C(F)(F)F | CNC(=O)c1c2cc(C3CC3)c(N(CCC3COC(C)(C)OC3)S(C)(=O)=O)cc2nn1-c1ccc(Br)cc1 |
|
|
|
|
|
|
| 08000002 01400000 00100000 92010610 00180062 00004140 00000c00 00000000 06000100 818000b0 0c00000c 40018000 00009000 0bc80110 00a81080 001c800c 00200120 82008000 09c00000 40001001 84080020 10000010 25800041 08300410 10040404 c0000002 20000200 90040060 00004200 01460000 40280004 00000280 | 00004006 0480de08 20180902 41310f00 211c0040 00006042 02840800 02001408 00300900 014908e0 09312024 40118800 80008c33 01400201 804a0040 002e300e 04268000 02000004 09608008 00224201 c0100121 1c838e38 2180c800 9360001c 02104480 c0000040 00270280 b400108c 0c488304 0046004b c4248088 a8114ff0 |