On Target NA_INFB 0.23225807/CHEMBL253625
For the given ligand Entecavir, we have found in our database that, being scored 0.23225807, the most similar ligand is CHEMBL253625. Check out the elaboration below.
| Entecavir (Given Ligand) | CHEMBL253625 (Similar Ligand) |
|---|---|
| C=C1[C@H](CO)[C@@H](O)C[C@@H]1n3cnc2c(=O)nc(N)[nH]c23 | C=CC[C@H](O)[C@H](NC(C)=O)[C@@H]1N[C@@H](C(=O)O)C[C@H]1/C=C\C |
|
|
|
|
|
|
| 0000000a 81801800 00080000 00000600 00180060 0000c040 0008b004 00000c00 16400100 809000e8 0000800c 40091000 00009000 01c00000 00080484 100c000c 00000000 00008100 09c12000 00200001 80000100 1c000050 21800840 00700014 00000000 80200000 60000000 80040000 00004008 01461000 e4080000 80000280 | 00010000 09007000 00100000 04000400 00080080 00000010 00080000 20000408 10000000 00108088 00200000 40013000 0602801a 01802001 80180404 00080008 10004000 00000040 00c12000 00000201 00000000 30040e30 03008081 02100018 00000001 00000000 00404000 90000000 0c000000 00040401 24024000 00002200 |