On Target PR_SARS 0.17910448/CHEMBL2441745
For the given ligand Trifluridine, we have found in our database that, being scored 0.17910448, the most similar ligand is CHEMBL2441745. Check out the elaboration below.
| Trifluridine (Given Ligand) | CHEMBL2441745 (Similar Ligand) |
|---|---|
| O=c2[nH]c(=O)n([C@H]1C[C@H](O)[C@@H](CO)O1)cc2C(F)(F)F | CC(C)C[C@H](NC(=O)[C@H](Cc1cccc2ccccc12)NC(=O)OCc1ccccc1)C(=O)N[C@@H](C[C@@H]1CCNC1=O)C(=O)C(=O)NC(C)C |
|
|
|
|
|
|
| 08000002 01400000 00100000 92010610 00180062 00004140 00000c00 00000000 06000100 818000b0 0c00000c 40018000 00009000 0bc80110 00a81080 001c800c 00200120 82008000 09c00000 40001001 84080020 10000010 25800041 08300410 10040404 c0000002 20000200 90040060 00004200 01460000 40280004 00000280 | 01030000 01403600 00100100 04010600 00000000 0001c010 00000000 2000000c 04e00b00 000a09e0 08300000 4003b000 0e00801a 00012001 80000000 021e0008 00020000 02080401 00002898 00000201 00000100 382c0e38 00000003 83500018 00001800 80002002 00000000 10200020 0c000200 0006001b e0024000 00802600 |