On Target NS3_HCV1A 0.45833334/CHEMBL3980332
For the given ligand Elvitegravir, we have found in our database that, being scored 0.45833334, the most similar ligand is CHEMBL3980332. Check out the elaboration below.
| Elvitegravir (Given Ligand) | CHEMBL3980332 (Similar Ligand) |
|---|---|
| COc1cc3c(cc1Cc2cccc(Cl)c2F)c(=O)c(C(=O)O)cn3[C@H](CO)C(C)C | CC[C@@H](N[C@@H](C)CC(N)=O)c1ccc(Cl)c(C(=O)c2ccc(=O)[nH]c2)c1F |
|
|
|
|
|
|
| 00008042 0480d808 20104108 02010610 00041003 0000c070 06000000 01000208 02000100 c00808c4 08000004 40018800 02008806 00601000 81000041 000c600c 01000200 82004004 00600000 00860001 c0000000 18068b78 23804000 9650001c 00042040 e0001001 08000000 50040011 00400380 40068042 c2040000 00220600 | 080080c2 00804c00 00105100 02010610 00041201 00000050 30002000 03001000 06400800 40080fe0 0c300004 40009a00 0e008866 00201004 00100400 080c000c 03010200 03000004 00200410 00000201 c0000500 18068700 21804000 3050041c 00043000 e0000201 08040000 c0800181 00400180 00068012 a4040000 20022600 |