On Target NS3_HCV1B 0.41011235/CHEMBL231813
For the given ligand Daclatasvir, we have found in our database that, being scored 0.41011235, the most similar ligand is CHEMBL231813. Check out the elaboration below.
| Daclatasvir (Given Ligand) | CHEMBL231813 (Similar Ligand) |
|---|---|
| COC(=O)N[C@H](C(=O)N1CCC[C@H]1c6ncc(c5ccc(c4ccc(c3cnc([C@@H]2CCCN2C(=O)[C@@H](NC(=O)OC)C(C)C)[nH]3)cc4)cc5)[nH]6)C(C)C | CCC[C@H](NC(=O)[C@@H]1[C@H]2CCC[C@H]2CN1C(=O)[C@@H](NC(=O)[C@@H](NC(=O)c1cnccn1)C1CCCCC1)C(C)(C)C)C(=O)C(=O)NC1CC1 |
|
|
|
|
|
|
| 0000a00a 01003000 00100d00 14010e10 00000040 0011801a 01400000 20082049 00800300 000008d0 00218000 4001b800 0e008082 08102000 00020000 801e010c 00028000 06082022 04000018 50000a01 00200000 38070e10 31002001 02500018 00140001 80080002 00000208 100010e0 08014204 00e60801 e00048a0 20002200 | 10018002 01803400 00100800 14000c10 00000040 00100010 0000c000 20003009 14000000 000101a0 01290000 40013000 0e00801a 01102001 80820400 00040104 08020000 02000003 02002010 00000201 80000000 300f8e30 21004003 02100018 00141000 00000000 08000000 90000004 08000004 01060811 a0024000 80002200 |