On Target RT_HIV1 0.342723/CHEMBL3683710
For the given ligand Daclatasvir, we have found in our database that, being scored 0.342723, the most similar ligand is CHEMBL3683710. Check out the elaboration below.
| Daclatasvir (Given Ligand) | CHEMBL3683710 (Similar Ligand) |
|---|---|
| COC(=O)N[C@H](C(=O)N1CCC[C@H]1c6ncc(c5ccc(c4ccc(c3cnc([C@@H]2CCCN2C(=O)[C@@H](NC(=O)OC)C(C)C)[nH]3)cc4)cc5)[nH]6)C(C)C | COC(=O)N[C@H](C(=O)NCCC(F)C[C@@H](CO)N(C(C)C)S(=O)(=O)c1ccc(N)cc1)C(c1ccccc1)c1ccccc1 |
|
|
|
|
|
|
| 0000a00a 01003000 00100d00 14010e10 00000040 0011801a 01400000 20082049 00800300 000008d0 00218000 4001b800 0e008082 08102000 00020000 801e010c 00028000 06082022 04000018 50000a01 00200000 38070e10 31002001 02500018 00140001 80080002 00000208 100010e0 08014204 00e60801 e00048a0 20002200 | 00000012 01803200 01100100 05b10600 00080090 00818000 00000000 2100000c 00c40a00 004808c0 08302004 6001b000 0c008002 00802001 80600040 001e0408 100a2000 02080000 00402018 00006609 c0000100 38240e30 23100001 db500058 02000800 a0000006 00000060 5000006c 0c000680 2806000b a0004000 00012670 |