On Target RT_HIV1 0.30456853/CHEMBL4227326
For the given ligand Elvitegravir, we have found in our database that, being scored 0.30456853, the most similar ligand is CHEMBL4227326. Check out the elaboration below.
| Elvitegravir (Given Ligand) | CHEMBL4227326 (Similar Ligand) |
|---|---|
| COc1cc3c(cc1Cc2cccc(Cl)c2F)c(=O)c(C(=O)O)cn3[C@H](CO)C(C)C | C=C(C)[C@@H]1CC[C@]2(CNCCc3ccccn3)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC=C(c6ccc(C(=O)O)cc6)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12 |
|
|
|
|
|
|
| 00008042 0480d808 20104108 02010610 00041003 0000c070 06000000 01000208 02000100 c00808c4 08000004 40018800 02008806 00601000 81000041 000c600c 01000200 82004004 00600000 00860001 c0000000 18068b78 23804000 9650001c 00042040 e0001001 08000000 50040011 00400380 40068042 c2040000 00220600 | 0400000a 01000800 00104322 50050600 00040020 00004000 80000080 20000402 00000980 00180ac0 08308004 40818800 00028802 00200000 01020402 020c000c 00000400 0a000020 02212000 00000201 41000100 18228a30 20808020 81500014 01201000 80000000 00406040 d0000000 04400006 01060002 e4020000 20002600 |