On Target PR_SARS 0.40782124/CHEMBL2441741
For the given ligand Daclatasvir, we have found in our database that, being scored 0.40782124, the most similar ligand is CHEMBL2441741. Check out the elaboration below.
| Daclatasvir (Given Ligand) | CHEMBL2441741 (Similar Ligand) |
|---|---|
| COC(=O)N[C@H](C(=O)N1CCC[C@H]1c6ncc(c5ccc(c4ccc(c3cnc([C@@H]2CCCN2C(=O)[C@@H](NC(=O)OC)C(C)C)[nH]3)cc4)cc5)[nH]6)C(C)C | CC(C)C[C@H](NC(=O)[C@H](Cc1cccc2ccccc12)NC(=O)OCc1ccccc1)C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O |
|
|
|
|
|
|
| 0000a00a 01003000 00100d00 14010e10 00000040 0011801a 01400000 20082049 00800300 000008d0 00218000 4001b800 0e008082 08102000 00020000 801e010c 00028000 06082022 04000018 50000a01 00200000 38070e10 31002001 02500018 00140001 80080002 00000208 100010e0 08014204 00e60801 e00048a0 20002200 | 01030000 01403200 00100100 04010600 00000000 0001c010 00000000 2000000c 00e00b00 000a08c0 08300000 4003b000 0e00801a 00012001 80000000 021e0008 00020000 02080400 00002898 00000201 00000100 38240e38 00000003 83500018 00000800 80002002 00000000 10200020 0c000200 0006000b e0004000 00802600 |