On Target NSP15_SARS 0.26/CHEMBL2441741
For the given ligand Elvitegravir, we have found in our database that, being scored 0.26, the most similar ligand is CHEMBL2441741. Check out the elaboration below.
| Elvitegravir (Given Ligand) | CHEMBL2441741 (Similar Ligand) |
|---|---|
| COc1cc3c(cc1Cc2cccc(Cl)c2F)c(=O)c(C(=O)O)cn3[C@H](CO)C(C)C | CC(C)C[C@H](NC(=O)[C@H](Cc1cccc2ccccc12)NC(=O)OCc1ccccc1)C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O |
|
|
|
|
|
|
| 00008042 0480d808 20104108 02010610 00041003 0000c070 06000000 01000208 02000100 c00808c4 08000004 40018800 02008806 00601000 81000041 000c600c 01000200 82004004 00600000 00860001 c0000000 18068b78 23804000 9650001c 00042040 e0001001 08000000 50040011 00400380 40068042 c2040000 00220600 | 01030000 01403200 00100100 04010600 00000000 0001c010 00000000 2000000c 00e00b00 000a08c0 08300000 4003b000 0e00801a 00012001 80000000 021e0008 00020000 02080400 00002898 00000201 00000100 38240e38 00000003 83500018 00000800 80002002 00000000 10200020 0c000200 0006000b e0004000 00802600 |