On Target NP_HCoV-OC43 0.23030303/CHEMBL3233481
For the given ligand Elvitegravir, we have found in our database that, being scored 0.23030303, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| Elvitegravir (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| COc1cc3c(cc1Cc2cccc(Cl)c2F)c(=O)c(C(=O)O)cn3[C@H](CO)C(C)C | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 00008042 0480d808 20104108 02010610 00041003 0000c070 06000000 01000208 02000100 c00808c4 08000004 40018800 02008806 00601000 81000041 000c600c 01000200 82004004 00600000 00860001 c0000000 18068b78 23804000 9650001c 00042040 e0001001 08000000 50040011 00400380 40068042 c2040000 00220600 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |