On Target PA_INFA 0.20642202/CHEMBL2040569
For the given ligand Ribavirin, we have found in our database that, being scored 0.20642202, the most similar ligand is CHEMBL2040569. Check out the elaboration below.
| Ribavirin (Given Ligand) | CHEMBL2040569 (Similar Ligand) |
|---|---|
| NC(=O)c2ncn([C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O)n2 | O=C(NCC1CC1)c1nc(-c2cnccn2)[nH]c(=O)c1O |
|
|
|
|
|
|
| 00000004 01400008 c0100000 80010400 013800c0 00008004 00c00000 00000401 00000110 818000a0 08190028 44018810 00008000 03a00100 002a1080 001aa00c 00008000 00000002 19d00000 00201201 80180020 10000650 27014000 0e000410 10200410 40000402 00000800 31020060 01000305 00040001 80000080 00008108 | 00000202 00011808 40100100 10040e10 00000068 00124006 00c09800 28003405 16000100 401000a0 00290004 40040810 00008002 01708003 00820400 000c200c 08000068 1200b022 80c00000 10400201 00000000 50058600 21800040 4010011c 00044806 c0000680 28000030 90041004 0000410c 07660c01 e4008000 500002a0 |