On Target NS5B_HCV1B 0.35736677/CHEMBL3645198
For the given ligand Dolutegravir, we have found in our database that, being scored 0.35736677, the most similar ligand is CHEMBL3645198. Check out the elaboration below.
| Dolutegravir (Given Ligand) | CHEMBL3645198 (Similar Ligand) |
|---|---|
| C[C@@H]3CCO[C@H]4Cn2cc(C(=O)NCc1ccc(F)cc1F)c(=O)c(O)c2C(=O)N34 | CNC(=O)c1c2cc(C3CC3)c(N(CCCNC(=O)c3cccc(OC)c3F)S(C)(=O)=O)cc2nn1-c1ccc(Br)cc1 |
|
|
|
|
|
|
| 10000082 44c0fc08 60104100 d2010f90 0404102a 08128154 1c024000 82203401 02200301 805308d0 01290004 c0018000 80009806 08581100 00021c80 221e710c 02226200 82004106 00e00800 00160201 c0000021 383f8e10 23802081 6654013c 18152401 c0001082 08e00260 90240011 08440304 45068051 e40c0000 c0004200 | 00004086 4480de08 2018090a 43310e00 210c1000 00004052 02040000 02001408 00100900 004909e0 09312024 40118800 80008c73 01401201 818a4441 200e200e 06268a00 02000004 08680008 00225203 e0100101 3c8b8e38 2080c800 b364801c 02104080 c0000048 00270080 8000108d 0c488304 0046805b e4048088 a81147e0 |