On Target NS5B_HCV1B 0.24444444/CHEMBL3645202
For the given ligand Abacavir, we have found in our database that, being scored 0.24444444, the most similar ligand is CHEMBL3645202. Check out the elaboration below.
| Abacavir (Given Ligand) | CHEMBL3645202 (Similar Ligand) |
|---|---|
| Nc4nc(NC1CC1)c3ncn([C@H]2/C=C\[C@@H](CO)C2)c3n4 | CNC(=O)c1c2cc(C3CC3)c(N(CCCNC(=O)[C@H]3CCC[C@@H]3C(=O)OC)S(C)(=O)=O)cc2nn1-c1ccc(Br)cc1 |
|
|
|
|
|
|
| 0001001a 81801801 00181800 08080620 22180048 0000c010 0008a000 00100c02 10400100 001000c8 0020820c 41091000 04001000 01800000 000a0485 100c000c 20040000 00004140 08410000 80202001 80100000 1c040050 2180c844 00400014 00000002 00300000 00400400 800000c0 04020008 00461000 c4081000 000002c0 | 00074006 0180de08 20180902 41310f00 211c0000 00004042 02040000 22001408 00100900 004909e0 09312024 40119800 84008c3b 01c00201 808a0040 000e200e 04a68000 02000104 08602008 00225203 e0100101 1c8b8e38 2180c800 9370001c 02104080 c0000048 00270280 9000108c 0c488306 0146005b c4068088 a8916fe0 |