On Target NA_INFB 0.5145631/CHEMBL369125
For the given ligand Boceprevir, we have found in our database that, being scored 0.5145631, the most similar ligand is CHEMBL369125. Check out the elaboration below.
| Boceprevir (Given Ligand) | CHEMBL369125 (Similar Ligand) |
|---|---|
| CC(C)(C)NC(=O)N[C@H](C(=O)N1C[C@H]3[C@@H]([C@H]1C(=O)NC(CC2CCC2)C(=O)C(N)=O)C3(C)C)C(C)(C)C | COC(=O)[C@@H]1C[C@H](C(=O)O)N[C@H]1[C@H](CC(C)C)NC(C)=O |
|
|
|
|
|
|
| 00010000 01003400 00100000 04000c00 00000000 00000010 00000004 20002008 04000000 00020180 00200000 50013000 0e00b01a 01002011 80000000 00000000 00000010 00000001 00002050 00000201 00000100 300d0630 00000003 02100018 00011000 00000000 00000000 10000000 08000000 00040011 20024000 00002200 | 00030000 01003000 00100100 04010500 00180080 00000010 00000000 20000008 00000000 00020080 00200000 4001b000 0e00803a 03802001 80180000 00080008 10a20000 00000000 00c02010 00000201 00000000 30040e30 03000081 02100018 00001001 00000000 00000200 10000000 08000200 00040001 00024000 00802a00 |