On Target NA_INFB 0.2875/CHEMBL183817
For the given ligand Ribavirin, we have found in our database that, being scored 0.2875, the most similar ligand is CHEMBL183817. Check out the elaboration below.
| Ribavirin (Given Ligand) | CHEMBL183817 (Similar Ligand) |
|---|---|
| NC(=O)c2ncn([C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O)n2 | COC(=O)[C@@H]1C[C@H](C(=O)O)O[C@H]1[C@H](CC(C)C)NC(C)=O |
|
|
|
|
|
|
| 00000004 01400008 c0100000 80010400 013800c0 00008004 00c00000 00000401 00000110 818000a0 08190028 44018810 00008000 03a00100 002a1080 001aa00c 00008000 00000002 19d00000 00201201 80180020 10000650 27014000 0e000410 10200410 40000402 00000800 31020060 01000305 00040001 80000080 00008108 | 00070040 01005000 00100000 80010500 003c00c0 00200000 00000000 20000000 00000000 01020080 00200000 4001d000 1400802a 03800000 00081008 18099008 10820000 80000100 11402000 00000201 00000020 10040e10 17000000 0810001c 10000400 00000000 00800200 10000021 00000200 00040001 00020000 00800a00 |