On Target PLP_SARS 0.20103092/CHEMBL213054
For the given ligand Edoxudine, we have found in our database that, being scored 0.20103092, the most similar ligand is CHEMBL213054. Check out the elaboration below.
| Edoxudine (Given Ligand) | CHEMBL213054 (Similar Ligand) |
|---|---|
| CCc2cn([C@H]1C[C@H](O)[C@@H](CO)O1)c(=O)[nH]c2=O | CC(OC(C)(C)C)[C@H](NC(=O)OCc1ccccc1)C(=O)N[C@@H](CC1CCCCC1)C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O |
|
|
|
|
|
|
| 08000002 01402000 00001000 82010618 00180062 00004140 00002400 00000000 06400100 818800b0 2c00000c 40018000 00009000 03c80110 00a81080 001c800c 00200000 82008000 09c01000 40001001 84080020 10000010 25800041 08300414 10040400 c0000002 20000200 10040060 00004200 01460000 40280004 00000080 | 01030000 01407000 00100100 84010600 00040080 0023c010 00000000 20000008 00a00300 000208c0 00200000 4003b000 1e00801a 00092001 80001008 021a0008 00220000 02080400 02802890 01000201 00000020 38040e30 13000083 02500018 00000401 80002002 00800800 10200020 08000200 00060001 e0024000 00802200 |