On Target NS3_HCV1A 0.05/CHEMBL4107078
For the given ligand Foscarnet, we have found in our database that, being scored 0.05, the most similar ligand is CHEMBL4107078. Check out the elaboration below.
| Foscarnet (Given Ligand) | CHEMBL4107078 (Similar Ligand) |
|---|---|
| O=C(O)P(=O)(O)O | CC[C@@H](N)c1ccc(Cl)c(C(=O)c2cccc(C#N)c2)c1F |
|
|
|
|
|
|
| 00000000 00000800 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00008000 00020000 00000000 00000008 00000028 00080004 00000000 00000000 00000000 05400800 00000000 00000000 00000000 00000000 00000000 00014000 00000000 00000000 04000000 00008004 | 00008040 00000800 00100104 02010600 00000221 00000010 20000000 01001000 00000800 00880e40 08100000 40008a00 02008864 00001004 00000000 08080008 03400200 03000004 00a00400 00000001 00000500 18028300 01000400 10400014 00002000 a0000200 08040000 40800081 00000080 00068402 84040000 00020600 |