On Target NS3_HCV1B 0.23856209/CHEMBL3125634
For the given ligand Valganciclovir, we have found in our database that, being scored 0.23856209, the most similar ligand is CHEMBL3125634. Check out the elaboration below.
| Valganciclovir (Given Ligand) | CHEMBL3125634 (Similar Ligand) |
|---|---|
| CC(C)[C@H](N)C(=O)OCC(CO)OCn2cnc1c(=O)nc(N)[nH]c12 | CC(C)(C)NC(=O)Nc1nc(Cl)c(CCC2CCCCC2)n(CC(=O)Nc2ccccc2C(=O)NS(=O)(=O)c2ccc(C(F)(F)F)cc2)c1=O |
|
|
|
|
|
|
| 0000004a 00c01800 00080508 80010700 00080040 0000c100 0000bc04 00000840 06402100 810000f0 0c00800c 4000b010 04009000 00480000 00081080 101d900c 00220020 00008000 11400000 00201001 80080120 1c000a40 27800840 08300814 10000400 c0200002 60000200 10040060 00004208 00461008 c0200000 80000280 | 1001403a 05801800 011815e2 51b50e30 0408014c 08016040 0500ac05 00883101 16e00a01 f0083af0 08b8a06c 6010b980 05088808 03700801 80a309c2 08140004 8e246080 46504000 8a402408 00a06003 e0120580 78238700 21026800 0860041e 17048802 c1000704 48000410 900010ac 08048c1e 20c61811 803e2000 600383e8 |