On Target RT_HIV1 0.35911602/CHEMBL4225028
For the given ligand Nelfinavir, we have found in our database that, being scored 0.35911602, the most similar ligand is CHEMBL4225028. Check out the elaboration below.
| Nelfinavir (Given Ligand) | CHEMBL4225028 (Similar Ligand) |
|---|---|
| Cc1c(O)cccc1C(=O)N[C@@H](CSc2ccccc2)[C@H](O)CN4C[C@H]3CCCC[C@H]3C[C@H]4C(=O)NC(C)(C)C | C=C(C)[C@@H]1CC[C@]2(CNCCN3CCS(=O)(=O)CC3)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC=C(c6ccc(C(=O)O)cc6)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12 |
|
|
|
|
|
|
| 00010008 45805e08 20120100 1c110600 00000080 80008000 02000000 22001000 04000000 020049e0 00600000 7005b000 0601880a 00242102 86180400 20082008 14000000 02000000 02006000 00020301 80020000 390a8610 03800501 0654001d 00002000 c0000000 00004200 90000010 08001100 00060011 b0064000 03012220 | 00000000 45000800 20100302 4c150600 00000000 00004000 80000080 20000402 00020900 021c48c0 08302000 40018800 00028006 00242000 80000402 00080008 04000400 02010020 02012000 00000201 01000100 38020a30 00008261 06580014 01200000 80000000 00406000 d0000000 08400002 01060002 e4020000 02010620 |